C12H14Cl2N4 — CID 63329248
N-[(2,6-dichlorophenyl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine (PubChem CID 63329248) has the molecular formula C12H14Cl2N4 and a molecular weight of 285.18 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 63329248 |
| Molecular Formula | C12H14Cl2N4 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine |
| SMILES | Cn1cnnc1CCNCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H14Cl2N4/c1-18-8-16-17-12(18)5-6-15-7-9-10(13)3-2-4-11(9)14/h2-4,8,15H,5-7H2,1H3 |
| InChIKey | QIEVTDNRZVPEAR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|