C9H11ClN4S — CID 104878423
N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-imidazol-1-ylethanamine (PubChem CID 104878423) has the molecular formula C9H11ClN4S and a molecular weight of 242.74 g/mol. Its IUPAC name is N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-imidazol-1-ylethanamine.
| Compound Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-imidazol-1-ylethanamine |
|---|---|
| PubChem CID | 104878423 |
| Molecular Formula | C9H11ClN4S |
| Molecular Weight | 242.74 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-imidazol-1-ylethanamine |
| SMILES | Clc1cnc(CNCCn2ccnc2)s1 |
| InChI | InChI=1S/C9H11ClN4S/c10-8-5-13-9(15-8)6-11-1-3-14-4-2-12-7-14/h2,4-5,7,11H,1,3,6H2 |
| InChIKey | AFOUBXHJXVFCAW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.74 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|