C9H12N4S — CID 62999538
2-imidazol-1-yl-N-(1,3-thiazol-2-ylmethyl)ethanamine (PubChem CID 62999538) has the molecular formula C9H12N4S and a molecular weight of 208.29 g/mol. Its IUPAC name is 2-imidazol-1-yl-N-(1,3-thiazol-2-ylmethyl)ethanamine.
| Compound Name | 2-imidazol-1-yl-N-(1,3-thiazol-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 62999538 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-imidazol-1-yl-N-(1,3-thiazol-2-ylmethyl)ethanamine |
| SMILES | c1cn(CCNCc2nccs2)cn1 |
| InChI | InChI=1S/C9H12N4S/c1(4-13-5-2-11-8-13)10-7-9-12-3-6-14-9/h2-3,5-6,8,10H,1,4,7H2 |
| InChIKey | PGKJQCITFFGSGR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|