C11H13Br2N3S — CID 103005329
N-[(4,5-dibromothiophen-2-yl)methyl]-2-(2-methylpyrazol-3-yl)ethanamine (PubChem CID 103005329) has the molecular formula C11H13Br2N3S and a molecular weight of 379.12 g/mol. Its IUPAC name is N-[(4,5-dibromothiophen-2-yl)methyl]-2-(2-methylpyrazol-3-yl)ethanamine.
| Compound Name | N-[(4,5-dibromothiophen-2-yl)methyl]-2-(2-methylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 103005329 |
| Molecular Formula | C11H13Br2N3S |
| Molecular Weight | 379.12 g/mol |
| Exact Mass | 376.92 |
| IUPAC Name | N-[(4,5-dibromothiophen-2-yl)methyl]-2-(2-methylpyrazol-3-yl)ethanamine |
| SMILES | Cn1nccc1CCNCc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H13Br2N3S/c1-16-8(3-5-15-16)2-4-14-7-9-6-10(12)11(13)17-9/h3,5-6,14H,2,4,7H2,1H3 |
| InChIKey | HMUZBZYXFNBFAV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.12 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|