C11H20ClN3S — CID 104878961
N'-butan-2-yl-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-N'-methylethane-1,2-diamine (PubChem CID 104878961) has the molecular formula C11H20ClN3S and a molecular weight of 261.82 g/mol. Its IUPAC name is N'-butan-2-yl-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-N'-methylethane-1,2-diamine.
| Compound Name | N'-butan-2-yl-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 104878961 |
| Molecular Formula | C11H20ClN3S |
| Molecular Weight | 261.82 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N'-butan-2-yl-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-N'-methylethane-1,2-diamine |
| SMILES | CCC(C)N(C)CCNCc1ncc(Cl)s1 |
| InChI | InChI=1S/C11H20ClN3S/c1-4-9(2)15(3)6-5-13-8-11-14-7-10(12)16-11/h7,9,13H,4-6,8H2,1-3H3 |
| InChIKey | AZTCINVSDOHDMD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.82 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|