C8H14FN3O — CID 103790275
3-fluoro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]propan-1-amine (PubChem CID 103790275) has the molecular formula C8H14FN3O and a molecular weight of 187.22 g/mol. Its IUPAC name is 3-fluoro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]propan-1-amine.
| Compound Name | 3-fluoro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 103790275 |
| Molecular Formula | C8H14FN3O |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 3-fluoro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]propan-1-amine |
| SMILES | Cc1nc(CCNCCCF)no1 |
| InChI | InChI=1S/C8H14FN3O/c1-7-11-8(12-13-7)3-6-10-5-2-4-9/h10H,2-6H2,1H3 |
| InChIKey | LRSAIFWSHUEIOO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|