C7H13N3O — CID 83872807
4-(5-methyl-1,2,4-oxadiazol-3-yl)butan-1-amine (PubChem CID 83872807) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 4-(5-methyl-1,2,4-oxadiazol-3-yl)butan-1-amine.
| Compound Name | 4-(5-methyl-1,2,4-oxadiazol-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 83872807 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 4-(5-methyl-1,2,4-oxadiazol-3-yl)butan-1-amine |
| SMILES | Cc1nc(CCCCN)no1 |
| InChI | InChI=1S/C7H13N3O/c1-6-9-7(10-11-6)4-2-3-5-8/h2-5,8H2,1H3 |
| InChIKey | FMDCLSJZFKINCW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|