C6H13N3O — CID 143984808
ethane;(5-methyl-1,2,4-oxadiazol-3-yl)methanamine (PubChem CID 143984808) has the molecular formula C6H13N3O and a molecular weight of 143.19 g/mol. Its IUPAC name is ethane;(5-methyl-1,2,4-oxadiazol-3-yl)methanamine.
| Compound Name | ethane;(5-methyl-1,2,4-oxadiazol-3-yl)methanamine |
|---|---|
| PubChem CID | 143984808 |
| Molecular Formula | C6H13N3O |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | ethane;(5-methyl-1,2,4-oxadiazol-3-yl)methanamine |
| SMILES | CC.Cc1nc(CN)no1 |
| InChI | InChI=1S/C4H7N3O.C2H6/c1-3-6-4(2-5)7-8-3;1-2/h2,5H2,1H3;1-2H3 |
| InChIKey | GVLYMAPGCZESHE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |