About 3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide
3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide (PubChem CID 143084717) has the molecular formula C6H13IN2O
and a molecular weight of 256.09 g/mol. Its IUPAC name is 3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide.
Molecular Properties
| Compound Name | 3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide |
| PubChem CID | 143084717 |
| Molecular Formula | C6H13IN2O |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide |
| SMILES | CC.Cc1noc(C)n1.I |
| InChI | InChI=1S/C4H6N2O.C2H6.HI/c1-3-5-4(2)7-6-3;1-2;/h1-2H3;1-2H3;1H |
| InChIKey | VOWAFRIWICJUOC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide?
The IUPAC name of 3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide (CID 143084717) is 3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide.
What is the SMILES notation for 3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide?
The canonical SMILES for 3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide is CC.Cc1noc(C)n1.I.
What is the InChIKey of 3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide?
The InChIKey is VOWAFRIWICJUOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O.C2H6.HI/c1-3-5-4(2)7-6-3;1-2;/h1-2H3;1-2H3;1H.
What are the key properties of 3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide?
3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide has a molecular weight of 256.09 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide is sourced from PubChem (CID 143084717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).