C6H13IN2O — CID 143084717
3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide (PubChem CID 143084717) has the molecular formula C6H13IN2O and a molecular weight of 256.09 g/mol. Its IUPAC name is 3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide.
| Compound Name | 3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide |
|---|---|
| PubChem CID | 143084717 |
| Molecular Formula | C6H13IN2O |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 3,5-dimethyl-1,2,4-oxadiazole;ethane;hydroiodide |
| SMILES | CC.Cc1noc(C)n1.I |
| InChI | InChI=1S/C4H6N2O.C2H6.HI/c1-3-5-4(2)7-6-3;1-2;/h1-2H3;1-2H3;1H |
| InChIKey | VOWAFRIWICJUOC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|