C3H5N2OP — CID 135269813
(3-methyl-1,2,4-oxadiazol-5-yl)phosphane (PubChem CID 135269813) has the molecular formula C3H5N2OP and a molecular weight of 116.06 g/mol. Its IUPAC name is (3-methyl-1,2,4-oxadiazol-5-yl)phosphane.
| Compound Name | (3-methyl-1,2,4-oxadiazol-5-yl)phosphane |
|---|---|
| PubChem CID | 135269813 |
| Molecular Formula | C3H5N2OP |
| Molecular Weight | 116.06 g/mol |
| Exact Mass | 116.01 |
| IUPAC Name | (3-methyl-1,2,4-oxadiazol-5-yl)phosphane |
| SMILES | Cc1noc(P)n1 |
| InChI | InChI=1S/C3H5N2OP/c1-2-4-3(7)6-5-2/h7H2,1H3 |
| InChIKey | CRSGZQXGSFMBDY-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.06 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|