C9H12N2O2 — CID 63346585
4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-one (PubChem CID 63346585) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-one.
| Compound Name | 4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 63346585 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-one |
| SMILES | Cc1noc(C2CCC(=O)CC2)n1 |
| InChI | InChI=1S/C9H12N2O2/c1-6-10-9(13-11-6)7-2-4-8(12)5-3-7/h7H,2-5H2,1H3 |
| InChIKey | IKBWGTJNGDKJTL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |