About 3-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopentan-1-amine
3-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopentan-1-amine (PubChem CID 66033169) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopentan-1-amine.
Analyze 3-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopentan-1-amine?
The IUPAC name of 3-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopentan-1-amine (CID 66033169) is 3-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopentan-1-amine.
What is the SMILES notation for 3-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopentan-1-amine?
The canonical SMILES for 3-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopentan-1-amine is Cc1noc(C2CCC(N)C2)n1.
What is the InChIKey of 3-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopentan-1-amine?
The InChIKey is RRGLKRIKGJGJAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-5-10-8(12-11-5)6-2-3-7(9)4-6/h6-7H,2-4,9H2,1H3.
What are the key properties of 3-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopentan-1-amine?
3-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopentan-1-amine has a molecular weight of 167.21 g/mol, XLogP of 0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopentan-1-amine is sourced from PubChem (CID 66033169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).