C17H25N3O — CID 66031395
3-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine (PubChem CID 66031395) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 3-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine.
| Compound Name | 3-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 66031395 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 3-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine |
| SMILES | NC1CCC(c2nc(C34CC5CC(CC(C5)C3)C4)no2)C1 |
| InChI | InChI=1S/C17H25N3O/c18-14-2-1-13(6-14)15-19-16(20-21-15)17-7-10-3-11(8-17)5-12(4-10)9-17/h10-14H,1-9,18H2 |
| InChIKey | IKIRVSISXFBATF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |