C4H7N3OS — CID 155238388
N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]thiohydroxylamine (PubChem CID 155238388) has the molecular formula C4H7N3OS and a molecular weight of 145.19 g/mol. Its IUPAC name is N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]thiohydroxylamine.
| Compound Name | N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]thiohydroxylamine |
|---|---|
| PubChem CID | 155238388 |
| Molecular Formula | C4H7N3OS |
| Molecular Weight | 145.19 g/mol |
| Exact Mass | 145.03 |
| IUPAC Name | N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]thiohydroxylamine |
| SMILES | Cc1noc(CNS)n1 |
| InChI | InChI=1S/C4H7N3OS/c1-3-6-4(2-5-9)8-7-3/h5,9H,2H2,1H3 |
| InChIKey | HZRIJVOFKDWTJA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|