C8H15N3O3S — CID 61013517
2-ethylsulfonyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]ethanamine (PubChem CID 61013517) has the molecular formula C8H15N3O3S and a molecular weight of 233.29 g/mol. Its IUPAC name is 2-ethylsulfonyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]ethanamine.
| Compound Name | 2-ethylsulfonyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 61013517 |
| Molecular Formula | C8H15N3O3S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-ethylsulfonyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]ethanamine |
| SMILES | CCS(=O)(=O)CCNCc1nc(C)no1 |
| InChI | InChI=1S/C8H15N3O3S/c1-3-15(12,13)5-4-9-6-8-10-7(2)11-14-8/h9H,3-6H2,1-2H3 |
| InChIKey | KZPXKFLVIZCMQJ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|