C4H6ClN3O — CID 165372391
N-chloro-1-(3-methyl-1,2,4-oxadiazol-5-yl)methanamine (PubChem CID 165372391) has the molecular formula C4H6ClN3O and a molecular weight of 147.56 g/mol. Its IUPAC name is N-chloro-1-(3-methyl-1,2,4-oxadiazol-5-yl)methanamine.
| Compound Name | N-chloro-1-(3-methyl-1,2,4-oxadiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 165372391 |
| Molecular Formula | C4H6ClN3O |
| Molecular Weight | 147.56 g/mol |
| Exact Mass | 147.02 |
| IUPAC Name | N-chloro-1-(3-methyl-1,2,4-oxadiazol-5-yl)methanamine |
| SMILES | Cc1noc(CNCl)n1 |
| InChI | InChI=1S/C4H6ClN3O/c1-3-7-4(2-6-5)9-8-3/h6H,2H2,1H3 |
| InChIKey | TVXPIOXLILIDGW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.56 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|