C5H9N3OS — CID 155439756
N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]thiohydroxylamine (PubChem CID 155439756) has the molecular formula C5H9N3OS and a molecular weight of 159.21 g/mol. Its IUPAC name is N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]thiohydroxylamine.
| Compound Name | N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]thiohydroxylamine |
|---|---|
| PubChem CID | 155439756 |
| Molecular Formula | C5H9N3OS |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]thiohydroxylamine |
| SMILES | Cc1noc(CCNS)n1 |
| InChI | InChI=1S/C5H9N3OS/c1-4-7-5(9-8-4)2-3-6-10/h6,10H,2-3H2,1H3 |
| InChIKey | KCVIQLIZFYGKIE-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|