About N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxan-4-amine
N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxan-4-amine (PubChem CID 61014456) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxan-4-amine.
Analyze N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxan-4-amine?
The IUPAC name of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxan-4-amine (CID 61014456) is N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxan-4-amine.
What is the SMILES notation for N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxan-4-amine?
The canonical SMILES for N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxan-4-amine is Cc1noc(CNC2CCOCC2)n1.
What is the InChIKey of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxan-4-amine?
The InChIKey is DSFAFBYQLFDBCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-7-11-9(14-12-7)6-10-8-2-4-13-5-3-8/h8,10H,2-6H2,1H3.
What are the key properties of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxan-4-amine?
N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxan-4-amine has a molecular weight of 197.24 g/mol, XLogP of 0.65, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxan-4-amine is sourced from PubChem (CID 61014456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).