About 1-[(3-methyl-1,2,4-oxadiazol-5-yl)oxy]propan-2-one
1-[(3-methyl-1,2,4-oxadiazol-5-yl)oxy]propan-2-one (PubChem CID 130671415) has the molecular formula C6H8N2O3
and a molecular weight of 156.14 g/mol. Its IUPAC name is 1-[(3-methyl-1,2,4-oxadiazol-5-yl)oxy]propan-2-one.
Analyze 1-[(3-methyl-1,2,4-oxadiazol-5-yl)oxy]propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-methyl-1,2,4-oxadiazol-5-yl)oxy]propan-2-one?
The IUPAC name of 1-[(3-methyl-1,2,4-oxadiazol-5-yl)oxy]propan-2-one (CID 130671415) is 1-[(3-methyl-1,2,4-oxadiazol-5-yl)oxy]propan-2-one.
What is the SMILES notation for 1-[(3-methyl-1,2,4-oxadiazol-5-yl)oxy]propan-2-one?
The canonical SMILES for 1-[(3-methyl-1,2,4-oxadiazol-5-yl)oxy]propan-2-one is CC(=O)COc1nc(C)no1.
What is the InChIKey of 1-[(3-methyl-1,2,4-oxadiazol-5-yl)oxy]propan-2-one?
The InChIKey is JJSDGDAUIXJPHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3/c1-4(9)3-10-6-7-5(2)8-11-6/h3H2,1-2H3.
What are the key properties of 1-[(3-methyl-1,2,4-oxadiazol-5-yl)oxy]propan-2-one?
1-[(3-methyl-1,2,4-oxadiazol-5-yl)oxy]propan-2-one has a molecular weight of 156.14 g/mol, XLogP of 0.35, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-methyl-1,2,4-oxadiazol-5-yl)oxy]propan-2-one is sourced from PubChem (CID 130671415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).