C6H8N2O3 — CID 21312932
(3-methyl-1,2,4-oxadiazol-5-yl) propanoate (PubChem CID 21312932) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is (3-methyl-1,2,4-oxadiazol-5-yl) propanoate.
| Compound Name | (3-methyl-1,2,4-oxadiazol-5-yl) propanoate |
|---|---|
| PubChem CID | 21312932 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | (3-methyl-1,2,4-oxadiazol-5-yl) propanoate |
| SMILES | CCC(=O)Oc1nc(C)no1 |
| InChI | InChI=1S/C6H8N2O3/c1-3-5(9)10-6-7-4(2)8-11-6/h3H2,1-2H3 |
| InChIKey | BSVUSXGZCBVQCK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |