C7H6N4O3 — CID 90843715
bis(5-methyl-1,2,4-oxadiazol-3-yl)methanone (PubChem CID 90843715) has the molecular formula C7H6N4O3 and a molecular weight of 194.15 g/mol. Its IUPAC name is bis(5-methyl-1,2,4-oxadiazol-3-yl)methanone.
| Compound Name | bis(5-methyl-1,2,4-oxadiazol-3-yl)methanone |
|---|---|
| PubChem CID | 90843715 |
| Molecular Formula | C7H6N4O3 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | bis(5-methyl-1,2,4-oxadiazol-3-yl)methanone |
| SMILES | Cc1nc(C(=O)c2noc(C)n2)no1 |
| InChI | InChI=1S/C7H6N4O3/c1-3-8-6(10-13-3)5(12)7-9-4(2)14-11-7/h1-2H3 |
| InChIKey | WEDNKWJZJAQKBV-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |