C8H9Cl2N3O2 — CID 167767532
N-(3,3-dichlorocyclobutyl)-5-methyl-1,2,4-oxadiazole-3-carboxamide (PubChem CID 167767532) has the molecular formula C8H9Cl2N3O2 and a molecular weight of 250.08 g/mol. Its IUPAC name is N-(3,3-dichlorocyclobutyl)-5-methyl-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | N-(3,3-dichlorocyclobutyl)-5-methyl-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 167767532 |
| Molecular Formula | C8H9Cl2N3O2 |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | N-(3,3-dichlorocyclobutyl)-5-methyl-1,2,4-oxadiazole-3-carboxamide |
| SMILES | Cc1nc(C(=O)NC2CC(Cl)(Cl)C2)no1 |
| InChI | InChI=1S/C8H9Cl2N3O2/c1-4-11-6(13-15-4)7(14)12-5-2-8(9,10)3-5/h5H,2-3H2,1H3,(H,12,14) |
| InChIKey | VPEYAMAAEBMHIS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|