C4H3LiN2O3 — CID 134690810
lithium 5-methyl-1,2,4-oxadiazole-3-carboxylate (PubChem CID 134690810) has the molecular formula C4H3LiN2O3 and a molecular weight of 134.02 g/mol. Its IUPAC name is lithium 5-methyl-1,2,4-oxadiazole-3-carboxylate.
| Compound Name | lithium 5-methyl-1,2,4-oxadiazole-3-carboxylate |
|---|---|
| PubChem CID | 134690810 |
| Molecular Formula | C4H3LiN2O3 |
| Molecular Weight | 134.02 g/mol |
| Exact Mass | 134.03 |
| IUPAC Name | lithium 5-methyl-1,2,4-oxadiazole-3-carboxylate |
| SMILES | Cc1nc(C(=O)[O-])no1.[Li+] |
| InChI | InChI=1S/C4H4N2O3.Li/c1-2-5-3(4(7)8)6-9-2;/h1H3,(H,7,8);/q;+1/p-1 |
| InChIKey | PDGXBUGQQMGDFT-UHFFFAOYSA-M |
| XLogP | -4.25 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.02 |
| LogP ≤ 5 | -4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |