potassium 5-amino-1,2,4-oxadiazole-3-carboxylate

C3H2KN3O3 — CID 178200930

IUPACpotassium 5-amino-1,2,4-oxadiazole-3-carboxylate
SMILESNc1nc(C(=O)[O-])no1.[K+]
InChIInChI=1S/C3H3N3O3.K/c4-3-5-1(2(7)8)6-9-3;/h(H,7,8)(H2,4,5,6);/q;+1/p-1
InChIKeyQBYUJPRZUCNGDS-UHFFFAOYSA-M
MW167.16 g/mol
LogP-4.98
Rot. Bonds1

About potassium 5-amino-1,2,4-oxadiazole-3-carboxylate

potassium 5-amino-1,2,4-oxadiazole-3-carboxylate (PubChem CID 178200930) has the molecular formula C3H2KN3O3 and a molecular weight of 167.16 g/mol. Its IUPAC name is potassium 5-amino-1,2,4-oxadiazole-3-carboxylate.

Molecular Properties

Compound Namepotassium 5-amino-1,2,4-oxadiazole-3-carboxylate
PubChem CID178200930
Molecular FormulaC3H2KN3O3
Molecular Weight167.16 g/mol
Exact Mass166.97
IUPAC Namepotassium 5-amino-1,2,4-oxadiazole-3-carboxylate
SMILESNc1nc(C(=O)[O-])no1.[K+]
InChIInChI=1S/C3H3N3O3.K/c4-3-5-1(2(7)8)6-9-3;/h(H,7,8)(H2,4,5,6);/q;+1/p-1
InChIKeyQBYUJPRZUCNGDS-UHFFFAOYSA-M
XLogP-4.98
TPSA105.07 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.16
LogP ≤ 5-4.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze potassium 5-amino-1,2,4-oxadiazole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 5-amino-1,2,4-oxadiazole-3-carboxylate?
The IUPAC name of potassium 5-amino-1,2,4-oxadiazole-3-carboxylate (CID 178200930) is potassium 5-amino-1,2,4-oxadiazole-3-carboxylate.
What is the SMILES notation for potassium 5-amino-1,2,4-oxadiazole-3-carboxylate?
The canonical SMILES for potassium 5-amino-1,2,4-oxadiazole-3-carboxylate is Nc1nc(C(=O)[O-])no1.[K+].
What is the InChIKey of potassium 5-amino-1,2,4-oxadiazole-3-carboxylate?
The InChIKey is QBYUJPRZUCNGDS-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H3N3O3.K/c4-3-5-1(2(7)8)6-9-3;/h(H,7,8)(H2,4,5,6);/q;+1/p-1.
What are the key properties of potassium 5-amino-1,2,4-oxadiazole-3-carboxylate?
potassium 5-amino-1,2,4-oxadiazole-3-carboxylate has a molecular weight of 167.16 g/mol, XLogP of -4.98, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 5-amino-1,2,4-oxadiazole-3-carboxylate is sourced from PubChem (CID 178200930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).