C8H14Li2N2O14 — CID 139086700
dilithium;hydron;pyrazine-2,3,5,6-tetracarboxylate;hexahydrate (PubChem CID 139086700) has the molecular formula C8H14Li2N2O14 and a molecular weight of 376.08 g/mol. Its IUPAC name is dilithium;hydron;pyrazine-2,3,5,6-tetracarboxylate;hexahydrate.
| Compound Name | dilithium;hydron;pyrazine-2,3,5,6-tetracarboxylate;hexahydrate |
|---|---|
| PubChem CID | 139086700 |
| Molecular Formula | C8H14Li2N2O14 |
| Molecular Weight | 376.08 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | dilithium;hydron;pyrazine-2,3,5,6-tetracarboxylate;hexahydrate |
| SMILES | O.O.O.O.O.O.O=C([O-])c1nc(C(=O)[O-])c(C(=O)[O-])nc1C(=O)[O-].[H+].[H+].[Li+].[Li+] |
| InChI | InChI=1S/C8H4N2O8.2Li.6H2O/c11-5(12)1-2(6(13)14)10-4(8(17)18)3(9-1)7(15)16;;;;;;;;/h(H,11,12)(H,13,14)(H,15,16)(H,17,18);;;6*1H2/q;2*+1;;;;;;/p-2 |
| InChIKey | GJPYWAYMTKZLSX-UHFFFAOYSA-L |
| XLogP | -16.78 |
| TPSA | 375.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.08 |
| LogP ≤ 5 | -16.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |