C6H12N6O — CID 106419327
1-amino-2-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]guanidine (PubChem CID 106419327) has the molecular formula C6H12N6O and a molecular weight of 184.20 g/mol. Its IUPAC name is 1-amino-2-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]guanidine.
| Compound Name | 1-amino-2-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 106419327 |
| Molecular Formula | C6H12N6O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 1-amino-2-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]guanidine |
| SMILES | Cc1nc(CC/N=C(\N)NN)no1 |
| InChI | InChI=1S/C6H12N6O/c1-4-10-5(12-13-4)2-3-9-6(7)11-8/h2-3,8H2,1H3,(H3,7,9,11) |
| InChIKey | PQNIRJSDCDLRSC-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|