C12H19N5O — CID 113229290
2-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]ethanamine (PubChem CID 113229290) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is 2-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]ethanamine.
| Compound Name | 2-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 113229290 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 2-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]ethanamine |
| SMILES | Cc1nc(CCNCc2c(C)nn(C)c2C)no1 |
| InChI | InChI=1S/C12H19N5O/c1-8-11(9(2)17(4)15-8)7-13-6-5-12-14-10(3)18-16-12/h13H,5-7H2,1-4H3 |
| InChIKey | KTWJOAKDPIXHPG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|