C7H12ClN3O — CID 84662341
2-(4-chloro-1,3-dimethylpyrazol-5-yl)oxyethanamine (PubChem CID 84662341) has the molecular formula C7H12ClN3O and a molecular weight of 189.65 g/mol. Its IUPAC name is 2-(4-chloro-1,3-dimethylpyrazol-5-yl)oxyethanamine.
| Compound Name | 2-(4-chloro-1,3-dimethylpyrazol-5-yl)oxyethanamine |
|---|---|
| PubChem CID | 84662341 |
| Molecular Formula | C7H12ClN3O |
| Molecular Weight | 189.65 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 2-(4-chloro-1,3-dimethylpyrazol-5-yl)oxyethanamine |
| SMILES | Cc1nn(C)c(OCCN)c1Cl |
| InChI | InChI=1S/C7H12ClN3O/c1-5-6(8)7(11(2)10-5)12-4-3-9/h3-4,9H2,1-2H3 |
| InChIKey | HVTIDJAQZSMKHE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.65 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |