C9H17N3O2 — CID 43554429
5-(2-ethoxyethoxy)-1,3-dimethylpyrazol-4-amine (PubChem CID 43554429) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 5-(2-ethoxyethoxy)-1,3-dimethylpyrazol-4-amine.
| Compound Name | 5-(2-ethoxyethoxy)-1,3-dimethylpyrazol-4-amine |
|---|---|
| PubChem CID | 43554429 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 5-(2-ethoxyethoxy)-1,3-dimethylpyrazol-4-amine |
| SMILES | CCOCCOc1c(N)c(C)nn1C |
| InChI | InChI=1S/C9H17N3O2/c1-4-13-5-6-14-9-8(10)7(2)11-12(9)3/h4-6,10H2,1-3H3 |
| InChIKey | LMWPXZICSPIFHG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|