C11H21N3O3 — CID 103400910
5-[3-(2-methoxyethoxy)propoxy]-1,3-dimethylpyrazol-4-amine (PubChem CID 103400910) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is 5-[3-(2-methoxyethoxy)propoxy]-1,3-dimethylpyrazol-4-amine.
| Compound Name | 5-[3-(2-methoxyethoxy)propoxy]-1,3-dimethylpyrazol-4-amine |
|---|---|
| PubChem CID | 103400910 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 5-[3-(2-methoxyethoxy)propoxy]-1,3-dimethylpyrazol-4-amine |
| SMILES | COCCOCCCOc1c(N)c(C)nn1C |
| InChI | InChI=1S/C11H21N3O3/c1-9-10(12)11(14(2)13-9)17-6-4-5-16-8-7-15-3/h4-8,12H2,1-3H3 |
| InChIKey | BHTOLICKTQONFP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|