C11H21N3O — CID 43554474
5-hexoxy-1,3-dimethylpyrazol-4-amine (PubChem CID 43554474) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 5-hexoxy-1,3-dimethylpyrazol-4-amine.
| Compound Name | 5-hexoxy-1,3-dimethylpyrazol-4-amine |
|---|---|
| PubChem CID | 43554474 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 5-hexoxy-1,3-dimethylpyrazol-4-amine |
| SMILES | CCCCCCOc1c(N)c(C)nn1C |
| InChI | InChI=1S/C11H21N3O/c1-4-5-6-7-8-15-11-10(12)9(2)13-14(11)3/h4-8,12H2,1-3H3 |
| InChIKey | IJDOUURWIJYOHO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|