C10H17N3O — CID 43554361
5-cyclopentyloxy-1,3-dimethylpyrazol-4-amine (PubChem CID 43554361) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 5-cyclopentyloxy-1,3-dimethylpyrazol-4-amine.
| Compound Name | 5-cyclopentyloxy-1,3-dimethylpyrazol-4-amine |
|---|---|
| PubChem CID | 43554361 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 5-cyclopentyloxy-1,3-dimethylpyrazol-4-amine |
| SMILES | Cc1nn(C)c(OC2CCCC2)c1N |
| InChI | InChI=1S/C10H17N3O/c1-7-9(11)10(13(2)12-7)14-8-5-3-4-6-8/h8H,3-6,11H2,1-2H3 |
| InChIKey | UGMQHKYLARQQBV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |