C8H7FN2O — CID 133061751
4-fluoro-1-methylpyrrolo[3,2-c]pyridin-3-ol (PubChem CID 133061751) has the molecular formula C8H7FN2O and a molecular weight of 166.15 g/mol. Its IUPAC name is 4-fluoro-1-methylpyrrolo[3,2-c]pyridin-3-ol.
| Compound Name | 4-fluoro-1-methylpyrrolo[3,2-c]pyridin-3-ol |
|---|---|
| PubChem CID | 133061751 |
| Molecular Formula | C8H7FN2O |
| Molecular Weight | 166.15 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 4-fluoro-1-methylpyrrolo[3,2-c]pyridin-3-ol |
| SMILES | Cn1cc(O)c2c(F)nccc21 |
| InChI | InChI=1S/C8H7FN2O/c1-11-4-6(12)7-5(11)2-3-10-8(7)9/h2-4,12H,1H3 |
| InChIKey | VYGPFBOKAMKZRZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.15 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|