C5H4F3NS — CID 158959842
sulfane;2,3,4-trifluoropyridine (PubChem CID 158959842) has the molecular formula C5H4F3NS and a molecular weight of 167.16 g/mol. Its IUPAC name is sulfane;2,3,4-trifluoropyridine.
| Compound Name | sulfane;2,3,4-trifluoropyridine |
|---|---|
| PubChem CID | 158959842 |
| Molecular Formula | C5H4F3NS |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.00 |
| IUPAC Name | sulfane;2,3,4-trifluoropyridine |
| SMILES | Fc1ccnc(F)c1F.S |
| InChI | InChI=1S/C5H2F3N.H2S/c6-3-1-2-9-5(8)4(3)7;/h1-2H;1H2 |
| InChIKey | HFXQKKNHAFAWSK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|