C13H7F2N3 — CID 126751918
6-(2,3-difluoro-4-pyridinyl)-1,7-naphthyridine (PubChem CID 126751918) has the molecular formula C13H7F2N3 and a molecular weight of 243.22 g/mol. Its IUPAC name is 6-(2,3-difluoro-4-pyridinyl)-1,7-naphthyridine.
| Compound Name | 6-(2,3-difluoro-4-pyridinyl)-1,7-naphthyridine |
|---|---|
| PubChem CID | 126751918 |
| Molecular Formula | C13H7F2N3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 6-(2,3-difluoro-4-pyridinyl)-1,7-naphthyridine |
| SMILES | Fc1nccc(-c2cc3cccnc3cn2)c1F |
| InChI | InChI=1S/C13H7F2N3/c14-12-9(3-5-17-13(12)15)10-6-8-2-1-4-16-11(8)7-18-10/h1-7H |
| InChIKey | SOTKZRRGWRISNB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|