C12H7FN4O — CID 137128057
5-fluoro-4-(1,7-naphthyridin-6-yl)-1H-pyrimidin-6-one (PubChem CID 137128057) has the molecular formula C12H7FN4O and a molecular weight of 242.21 g/mol. Its IUPAC name is 5-fluoro-4-(1,7-naphthyridin-6-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-fluoro-4-(1,7-naphthyridin-6-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137128057 |
| Molecular Formula | C12H7FN4O |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 5-fluoro-4-(1,7-naphthyridin-6-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(-c2cc3cccnc3cn2)c1F |
| InChI | InChI=1S/C12H7FN4O/c13-10-11(16-6-17-12(10)18)8-4-7-2-1-3-14-9(7)5-15-8/h1-6H,(H,16,17,18) |
| InChIKey | FFBVBZPIQJQLEF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |