About 7-fluoro-1,6-naphthyridine
7-fluoro-1,6-naphthyridine (PubChem CID 58547450) has the molecular formula C8H5FN2
and a molecular weight of 148.14 g/mol. Its IUPAC name is 7-fluoro-1,6-naphthyridine.
Molecular Properties
| Compound Name | 7-fluoro-1,6-naphthyridine |
| PubChem CID | 58547450 |
| Molecular Formula | C8H5FN2 |
| Molecular Weight | 148.14 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | 7-fluoro-1,6-naphthyridine |
| SMILES | Fc1cc2ncccc2cn1 |
| InChI | InChI=1S/C8H5FN2/c9-8-4-7-6(5-11-8)2-1-3-10-7/h1-5H |
| InChIKey | WMYQMVHXZXUWDO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.14 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-1,6-naphthyridine?
The IUPAC name of 7-fluoro-1,6-naphthyridine (CID 58547450) is 7-fluoro-1,6-naphthyridine.
What is the SMILES notation for 7-fluoro-1,6-naphthyridine?
The canonical SMILES for 7-fluoro-1,6-naphthyridine is Fc1cc2ncccc2cn1.
What is the InChIKey of 7-fluoro-1,6-naphthyridine?
The InChIKey is WMYQMVHXZXUWDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5FN2/c9-8-4-7-6(5-11-8)2-1-3-10-7/h1-5H.
What are the key properties of 7-fluoro-1,6-naphthyridine?
7-fluoro-1,6-naphthyridine has a molecular weight of 148.14 g/mol, XLogP of 1.77, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1,6-naphthyridine is sourced from PubChem (CID 58547450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).