C19H12ClFN4O2S — CID 44608268
N-[2-chloro-5-(1,7-naphthyridin-6-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 44608268) has the molecular formula C19H12ClFN4O2S and a molecular weight of 414.85 g/mol. Its IUPAC name is N-[2-chloro-5-(1,7-naphthyridin-6-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-chloro-5-(1,7-naphthyridin-6-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 44608268 |
| Molecular Formula | C19H12ClFN4O2S |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | N-[2-chloro-5-(1,7-naphthyridin-6-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2cc3cccnc3cn2)cnc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H12ClFN4O2S/c20-19-17(25-28(26,27)15-5-3-14(21)4-6-15)9-13(10-24-19)16-8-12-2-1-7-22-18(12)11-23-16/h1-11,25H |
| InChIKey | NMNZLBWDJYTREC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|