C27H21ClFN5O3S — CID 44610480
N-[2-chloro-5-[3-(2-phenoxyethylamino)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 44610480) has the molecular formula C27H21ClFN5O3S and a molecular weight of 550.02 g/mol. Its IUPAC name is N-[2-chloro-5-[3-(2-phenoxyethylamino)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-chloro-5-[3-(2-phenoxyethylamino)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 44610480 |
| Molecular Formula | C27H21ClFN5O3S |
| Molecular Weight | 550.02 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | N-[2-chloro-5-[3-(2-phenoxyethylamino)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2ccc3ncc(NCCOc4ccccc4)nc3c2)cnc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H21ClFN5O3S/c28-27-25(34-38(35,36)22-9-7-20(29)8-10-22)15-19(16-32-27)18-6-11-23-24(14-18)33-26(17-31-23)30-12-13-37-21-4-2-1-3-5-21/h1-11,14-17,34H,12-13H2,(H,30,33) |
| InChIKey | AAAFUXDLSSIZPZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.02 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|