C23H19ClFN5O3S — CID 44609387
N-[2-chloro-5-(3-morpholin-4-ylquinoxalin-6-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 44609387) has the molecular formula C23H19ClFN5O3S and a molecular weight of 499.96 g/mol. Its IUPAC name is N-[2-chloro-5-(3-morpholin-4-ylquinoxalin-6-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-chloro-5-(3-morpholin-4-ylquinoxalin-6-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 44609387 |
| Molecular Formula | C23H19ClFN5O3S |
| Molecular Weight | 499.96 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | N-[2-chloro-5-(3-morpholin-4-ylquinoxalin-6-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2ccc3ncc(N4CCOCC4)nc3c2)cnc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H19ClFN5O3S/c24-23-21(29-34(31,32)18-4-2-17(25)3-5-18)12-16(13-27-23)15-1-6-19-20(11-15)28-22(14-26-19)30-7-9-33-10-8-30/h1-6,11-14,29H,7-10H2 |
| InChIKey | YKIWXNATSYCOKT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.96 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|