C26H25ClFN5O2S — CID 44608114
N-[2-chloro-5-[3-(cyclohexylmethylamino)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 44608114) has the molecular formula C26H25ClFN5O2S and a molecular weight of 526.04 g/mol. Its IUPAC name is N-[2-chloro-5-[3-(cyclohexylmethylamino)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-chloro-5-[3-(cyclohexylmethylamino)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 44608114 |
| Molecular Formula | C26H25ClFN5O2S |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | N-[2-chloro-5-[3-(cyclohexylmethylamino)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2ccc3ncc(NCC4CCCCC4)nc3c2)cnc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H25ClFN5O2S/c27-26-24(33-36(34,35)21-9-7-20(28)8-10-21)13-19(15-31-26)18-6-11-22-23(12-18)32-25(16-29-22)30-14-17-4-2-1-3-5-17/h6-13,15-17,33H,1-5,14H2,(H,30,32) |
| InChIKey | CFKJAZFCOSGTBJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|