C28H22ClFN4O2S — CID 53363523
N-[2-chloro-5-[4-[4-(dimethylamino)phenyl]quinolin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 53363523) has the molecular formula C28H22ClFN4O2S and a molecular weight of 533.03 g/mol. Its IUPAC name is N-[2-chloro-5-[4-[4-(dimethylamino)phenyl]quinolin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-chloro-5-[4-[4-(dimethylamino)phenyl]quinolin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 53363523 |
| Molecular Formula | C28H22ClFN4O2S |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | N-[2-chloro-5-[4-[4-(dimethylamino)phenyl]quinolin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | CN(C)c1ccc(-c2ccnc3ccc(-c4cnc(Cl)c(NS(=O)(=O)c5ccc(F)cc5)c4)cc23)cc1 |
| InChI | InChI=1S/C28H22ClFN4O2S/c1-34(2)22-8-3-18(4-9-22)24-13-14-31-26-12-5-19(15-25(24)26)20-16-27(28(29)32-17-20)33-37(35,36)23-10-6-21(30)7-11-23/h3-17,33H,1-2H3 |
| InChIKey | DCKNELOICLMUKN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|