C22H19ClFN5O2SSi — CID 86718338
N-[2-chloro-5-[3-(2-trimethylsilylethynyl)imidazo[1,2-b]pyridazin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 86718338) has the molecular formula C22H19ClFN5O2SSi and a molecular weight of 500.03 g/mol. Its IUPAC name is N-[2-chloro-5-[3-(2-trimethylsilylethynyl)imidazo[1,2-b]pyridazin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-chloro-5-[3-(2-trimethylsilylethynyl)imidazo[1,2-b]pyridazin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 86718338 |
| Molecular Formula | C22H19ClFN5O2SSi |
| Molecular Weight | 500.03 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | N-[2-chloro-5-[3-(2-trimethylsilylethynyl)imidazo[1,2-b]pyridazin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | C[Si](C)(C)C#Cc1cnc2ccc(-c3cnc(Cl)c(NS(=O)(=O)c4ccc(F)cc4)c3)nn12 |
| InChI | InChI=1S/C22H19ClFN5O2SSi/c1-33(2,3)11-10-17-14-25-21-9-8-19(27-29(17)21)15-12-20(22(23)26-13-15)28-32(30,31)18-6-4-16(24)5-7-18/h4-9,12-14,28H,1-3H3 |
| InChIKey | YHNCSFOQSPDTRE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.03 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|