C19H12FN5O2S — CID 134368297
N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 134368297) has the molecular formula C19H12FN5O2S and a molecular weight of 393.40 g/mol. Its IUPAC name is N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 134368297 |
| Molecular Formula | C19H12FN5O2S |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | N-[5-(3-ethynylimidazo[1,2-b]pyridazin-6-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | C#Cc1cnc2ccc(-c3cncc(NS(=O)(=O)c4ccc(F)cc4)c3)nn12 |
| InChI | InChI=1S/C19H12FN5O2S/c1-2-16-12-22-19-8-7-18(23-25(16)19)13-9-15(11-21-10-13)24-28(26,27)17-5-3-14(20)4-6-17/h1,3-12,24H |
| InChIKey | ZPFAMEZPHBDZJM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|