C12H10F2N2 — CID 154001326
2-(2,3-difluoro-4-pyridinyl)-N-methylaniline (PubChem CID 154001326) has the molecular formula C12H10F2N2 and a molecular weight of 220.22 g/mol. Its IUPAC name is 2-(2,3-difluoro-4-pyridinyl)-N-methylaniline.
| Compound Name | 2-(2,3-difluoro-4-pyridinyl)-N-methylaniline |
|---|---|
| PubChem CID | 154001326 |
| Molecular Formula | C12H10F2N2 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-(2,3-difluoro-4-pyridinyl)-N-methylaniline |
| SMILES | CNc1ccccc1-c1ccnc(F)c1F |
| InChI | InChI=1S/C12H10F2N2/c1-15-10-5-3-2-4-8(10)9-6-7-16-12(14)11(9)13/h2-7,15H,1H3 |
| InChIKey | RCPNYFKIPKQHCW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|