C34H26N4 — CID 139456017
2-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-N-methylaniline (PubChem CID 139456017) has the molecular formula C34H26N4 and a molecular weight of 490.61 g/mol. Its IUPAC name is 2-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-N-methylaniline.
| Compound Name | 2-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-N-methylaniline |
|---|---|
| PubChem CID | 139456017 |
| Molecular Formula | C34H26N4 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 2-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-N-methylaniline |
| SMILES | CNc1ccccc1-c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C34H26N4/c1-35-31-15-9-8-14-30(31)26-20-16-24(17-21-26)25-18-22-29(23-19-25)34-37-32(27-10-4-2-5-11-27)36-33(38-34)28-12-6-3-7-13-28/h2-23,35H,1H3 |
| InChIKey | QXHDQJDYPFQCRM-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |