C7H2F5NO — CID 171367494
1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone (PubChem CID 171367494) has the molecular formula C7H2F5NO and a molecular weight of 211.09 g/mol. Its IUPAC name is 1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 171367494 |
| Molecular Formula | C7H2F5NO |
| Molecular Weight | 211.09 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | 1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone |
| SMILES | O=C(c1ccnc(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C7H2F5NO/c8-4-3(1-2-13-6(4)9)5(14)7(10,11)12/h1-2H |
| InChIKey | JLCGRBYBDXYNKA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.09 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|