About 1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone
1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone (PubChem CID 171367494) has the molecular formula C7H2F5NO
and a molecular weight of 211.09 g/mol. Its IUPAC name is 1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone.
Molecular Properties
| Compound Name | 1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone |
| PubChem CID | 171367494 |
| Molecular Formula | C7H2F5NO |
| Molecular Weight | 211.09 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | 1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone |
| SMILES | O=C(c1ccnc(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C7H2F5NO/c8-4-3(1-2-13-6(4)9)5(14)7(10,11)12/h1-2H |
| InChIKey | JLCGRBYBDXYNKA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.09 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone?
The IUPAC name of 1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone (CID 171367494) is 1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone?
The canonical SMILES for 1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone is O=C(c1ccnc(F)c1F)C(F)(F)F.
What is the InChIKey of 1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone?
The InChIKey is JLCGRBYBDXYNKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2F5NO/c8-4-3(1-2-13-6(4)9)5(14)7(10,11)12/h1-2H.
What are the key properties of 1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone?
1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone has a molecular weight of 211.09 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-difluoro-4-pyridinyl)-2,2,2-trifluoroethanone is sourced from PubChem (CID 171367494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).