C27H21FN4O2S — CID 163251900
[6-(benzhydrylideneamino)-3-(2,4-dimethoxy-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl] thiohypofluorite (PubChem CID 163251900) has the molecular formula C27H21FN4O2S and a molecular weight of 484.56 g/mol. Its IUPAC name is [6-(benzhydrylideneamino)-3-(2,4-dimethoxy-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl] thiohypofluorite.
| Compound Name | [6-(benzhydrylideneamino)-3-(2,4-dimethoxy-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl] thiohypofluorite |
|---|---|
| PubChem CID | 163251900 |
| Molecular Formula | C27H21FN4O2S |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | [6-(benzhydrylideneamino)-3-(2,4-dimethoxy-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl] thiohypofluorite |
| SMILES | COc1ccnc(OC)c1-c1cn(SF)c2nc(N=C(c3ccccc3)c3ccccc3)ccc12 |
| InChI | InChI=1S/C27H21FN4O2S/c1-33-22-15-16-29-27(34-2)24(22)21-17-32(35-28)26-20(21)13-14-23(31-26)30-25(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-17H,1-2H3 |
| InChIKey | XXPIWDYTNJRQJO-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|