C26H20F2N4OS — CID 163252007
[[6-(benzhydrylideneamino)-3-(5-fluoro-2-methoxybenzenecarboximidoyl)-2-pyridinyl]amino] thiohypofluorite (PubChem CID 163252007) has the molecular formula C26H20F2N4OS and a molecular weight of 474.54 g/mol. Its IUPAC name is [[6-(benzhydrylideneamino)-3-(5-fluoro-2-methoxybenzenecarboximidoyl)-2-pyridinyl]amino] thiohypofluorite.
| Compound Name | [[6-(benzhydrylideneamino)-3-(5-fluoro-2-methoxybenzenecarboximidoyl)-2-pyridinyl]amino] thiohypofluorite |
|---|---|
| PubChem CID | 163252007 |
| Molecular Formula | C26H20F2N4OS |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | [[6-(benzhydrylideneamino)-3-(5-fluoro-2-methoxybenzenecarboximidoyl)-2-pyridinyl]amino] thiohypofluorite |
| SMILES | [H]/N=C(\c1cc(F)ccc1OC)c1ccc(N=C(c2ccccc2)c2ccccc2)nc1NSF |
| InChI | InChI=1S/C26H20F2N4OS/c1-33-22-14-12-19(27)16-21(22)24(29)20-13-15-23(31-26(20)32-34-28)30-25(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-16,29H,1H3,(H,31,32)/b29-24- |
| InChIKey | LSGXLOJCRAEBQQ-OLFWJLLRSA-N |
| XLogP | 6.76 |
| TPSA | 70.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|