C14H15N3O — CID 155481805
2-(2-methoxybenzenecarboximidoyl)benzene-1,4-diamine (PubChem CID 155481805) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-(2-methoxybenzenecarboximidoyl)benzene-1,4-diamine.
| Compound Name | 2-(2-methoxybenzenecarboximidoyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 155481805 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-(2-methoxybenzenecarboximidoyl)benzene-1,4-diamine |
| SMILES | [H]/N=C(/c1cc(N)ccc1N)c1ccccc1OC |
| InChI | InChI=1S/C14H15N3O/c1-18-13-5-3-2-4-10(13)14(17)11-8-9(15)6-7-12(11)16/h2-8,17H,15-16H2,1H3/b17-14+ |
| InChIKey | YARQFGFAPHABKC-SAPNQHFASA-N |
| XLogP | 2.28 |
| TPSA | 85.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|